C23H38N2O4 — CID 177357429
4-(4-acetylpiperidin-1-yl)-N-[2-(2-propan-2-yloxyethoxy)ethyl]benzamide;ethane (PubChem CID 177357429) has the molecular formula C23H38N2O4 and a molecular weight of 406.57 g/mol. Its IUPAC name is 4-(4-acetylpiperidin-1-yl)-N-[2-(2-propan-2-yloxyethoxy)ethyl]benzamide;ethane.
| Compound Name | 4-(4-acetylpiperidin-1-yl)-N-[2-(2-propan-2-yloxyethoxy)ethyl]benzamide;ethane |
|---|---|
| PubChem CID | 177357429 |
| Molecular Formula | C23H38N2O4 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.28 |
| IUPAC Name | 4-(4-acetylpiperidin-1-yl)-N-[2-(2-propan-2-yloxyethoxy)ethyl]benzamide;ethane |
| SMILES | CC.CC(=O)C1CCN(c2ccc(C(=O)NCCOCCOC(C)C)cc2)CC1 |
| InChI | InChI=1S/C21H32N2O4.C2H6/c1-16(2)27-15-14-26-13-10-22-21(25)19-4-6-20(7-5-19)23-11-8-18(9-12-23)17(3)24;1-2/h4-7,16,18H,8-15H2,1-3H3,(H,22,25);1-2H3 |
| InChIKey | YZWUOEQNPQIUDC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|