C14H26N2O4 — CID 177358218
3-[[4-(2-formamidoethoxymethyl)cyclohexyl]methoxy]propanamide (PubChem CID 177358218) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is 3-[[4-(2-formamidoethoxymethyl)cyclohexyl]methoxy]propanamide.
| Compound Name | 3-[[4-(2-formamidoethoxymethyl)cyclohexyl]methoxy]propanamide |
|---|---|
| PubChem CID | 177358218 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 3-[[4-(2-formamidoethoxymethyl)cyclohexyl]methoxy]propanamide |
| SMILES | NC(=O)CCOCC1CCC(COCCNC=O)CC1 |
| InChI | InChI=1S/C14H26N2O4/c15-14(18)5-7-19-9-12-1-3-13(4-2-12)10-20-8-6-16-11-17/h11-13H,1-10H2,(H2,15,18)(H,16,17) |
| InChIKey | GJYNZOQXINUYQR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|