About 3-ethylheptan-2-one;3-methyl-3-azaspiro[5.5]undecane-9-carboxamide
3-ethylheptan-2-one;3-methyl-3-azaspiro[5.5]undecane-9-carboxamide (PubChem CID 177358618) has the molecular formula C21H40N2O2
and a molecular weight of 352.56 g/mol. Its IUPAC name is 3-ethylheptan-2-one;3-methyl-3-azaspiro[5.5]undecane-9-carboxamide.
Molecular Properties
| Compound Name | 3-ethylheptan-2-one;3-methyl-3-azaspiro[5.5]undecane-9-carboxamide |
| PubChem CID | 177358618 |
| Molecular Formula | C21H40N2O2 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.31 |
| IUPAC Name | 3-ethylheptan-2-one;3-methyl-3-azaspiro[5.5]undecane-9-carboxamide |
| SMILES | CCCCC(CC)C(C)=O.CN1CCC2(CCC(C(N)=O)CC2)CC1 |
| InChI | InChI=1S/C12H22N2O.C9H18O/c1-14-8-6-12(7-9-14)4-2-10(3-5-12)11(13)15;1-4-6-7-9(5-2)8(3)10/h10H,2-9H2,1H3,(H2,13,15);9H,4-7H2,1-3H3 |
| InChIKey | NDWKEUVCHOBNJU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethylheptan-2-one;3-methyl-3-azaspiro[5.5]undecane-9-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylheptan-2-one;3-methyl-3-azaspiro[5.5]undecane-9-carboxamide?
The IUPAC name of 3-ethylheptan-2-one;3-methyl-3-azaspiro[5.5]undecane-9-carboxamide (CID 177358618) is 3-ethylheptan-2-one;3-methyl-3-azaspiro[5.5]undecane-9-carboxamide.
What is the SMILES notation for 3-ethylheptan-2-one;3-methyl-3-azaspiro[5.5]undecane-9-carboxamide?
The canonical SMILES for 3-ethylheptan-2-one;3-methyl-3-azaspiro[5.5]undecane-9-carboxamide is CCCCC(CC)C(C)=O.CN1CCC2(CCC(C(N)=O)CC2)CC1.
What is the InChIKey of 3-ethylheptan-2-one;3-methyl-3-azaspiro[5.5]undecane-9-carboxamide?
The InChIKey is NDWKEUVCHOBNJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O.C9H18O/c1-14-8-6-12(7-9-14)4-2-10(3-5-12)11(13)15;1-4-6-7-9(5-2)8(3)10/h10H,2-9H2,1H3,(H2,13,15);9H,4-7H2,1-3H3.
What are the key properties of 3-ethylheptan-2-one;3-methyl-3-azaspiro[5.5]undecane-9-carboxamide?
3-ethylheptan-2-one;3-methyl-3-azaspiro[5.5]undecane-9-carboxamide has a molecular weight of 352.56 g/mol, XLogP of 4.17, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylheptan-2-one;3-methyl-3-azaspiro[5.5]undecane-9-carboxamide is sourced from PubChem (CID 177358618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).