C33H35FN6O3 — CID 177358982
6-[3-[(1S)-8-ethyl-4-(4-fluoro-3,5-dimethylphenyl)-13-methyl-4,5,12-triazatricyclo[6.3.2.02,6]trideca-2,5-dien-3-yl]-2-oxoimidazol-1-yl]-1-methylindole-2,3-dione (PubChem CID 177358982) has the molecular formula C33H35FN6O3 and a molecular weight of 582.68 g/mol. Its IUPAC name is 6-[3-[(1S)-8-ethyl-4-(4-fluoro-3,5-dimethylphenyl)-13-methyl-4,5,12-triazatricyclo[6.3.2.02,6]trideca-2,5-dien-3-yl]-2-oxoimidazol-1-yl]-1-methylindole-2,3-dione.
| Compound Name | 6-[3-[(1S)-8-ethyl-4-(4-fluoro-3,5-dimethylphenyl)-13-methyl-4,5,12-triazatricyclo[6.3.2.02,6]trideca-2,5-dien-3-yl]-2-oxoimidazol-1-yl]-1-methylindole-2,3-dione |
|---|---|
| PubChem CID | 177358982 |
| Molecular Formula | C33H35FN6O3 |
| Molecular Weight | 582.68 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | 6-[3-[(1S)-8-ethyl-4-(4-fluoro-3,5-dimethylphenyl)-13-methyl-4,5,12-triazatricyclo[6.3.2.02,6]trideca-2,5-dien-3-yl]-2-oxoimidazol-1-yl]-1-methylindole-2,3-dione |
| SMILES | CCC12CCC[C@H](NC1C)c1c(nn(-c3cc(C)c(F)c(C)c3)c1-n1ccn(-c3ccc4c(c3)N(C)C(=O)C4=O)c1=O)C2 |
| InChI | InChI=1S/C33H35FN6O3/c1-6-33-11-7-8-24(35-20(33)4)27-25(17-33)36-40(22-14-18(2)28(34)19(3)15-22)30(27)39-13-12-38(32(39)43)21-9-10-23-26(16-21)37(5)31(42)29(23)41/h9-10,12-16,20,24,35H,6-8,11,17H2,1-5H3/t20?,24-,33?/m0/s1 |
| InChIKey | YSHSRWSQPBCKPR-FFBSGUCISA-N |
| XLogP | 4.88 |
| TPSA | 94.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.68 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|