C14H21F3N4S — CID 177359938
6-[4-(2,2,2-trifluoroethylamino)piperidin-1-yl]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine (PubChem CID 177359938) has the molecular formula C14H21F3N4S and a molecular weight of 334.41 g/mol. Its IUPAC name is 6-[4-(2,2,2-trifluoroethylamino)piperidin-1-yl]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine.
| Compound Name | 6-[4-(2,2,2-trifluoroethylamino)piperidin-1-yl]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 177359938 |
| Molecular Formula | C14H21F3N4S |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 6-[4-(2,2,2-trifluoroethylamino)piperidin-1-yl]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2c(s1)CC(N1CCC(NCC(F)(F)F)CC1)CC2 |
| InChI | InChI=1S/C14H21F3N4S/c15-14(16,17)8-19-9-3-5-21(6-4-9)10-1-2-11-12(7-10)22-13(18)20-11/h9-10,19H,1-8H2,(H2,18,20) |
| InChIKey | DUWURQAPLVCMEA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |