About dipotassium;1-(chloromethyl)-3-(fluoromethyl)benzene-2-ide
dipotassium;1-(chloromethyl)-3-(fluoromethyl)benzene-2-ide (PubChem CID 177360349) has the molecular formula C8H6ClFK2
and a molecular weight of 234.78 g/mol. Its IUPAC name is dipotassium;1-(chloromethyl)-3-(fluoromethyl)benzene-2-ide.
Molecular Properties
| Compound Name | dipotassium;1-(chloromethyl)-3-(fluoromethyl)benzene-2-ide |
| PubChem CID | 177360349 |
| Molecular Formula | C8H6ClFK2 |
| Molecular Weight | 234.78 g/mol |
| Exact Mass | 233.94 |
| IUPAC Name | dipotassium;1-(chloromethyl)-3-(fluoromethyl)benzene-2-ide |
| SMILES | F[CH-]c1[c-]c(CCl)ccc1.[K+].[K+] |
| InChI | InChI=1S/C8H6ClF.2K/c9-5-7-2-1-3-8(4-7)6-10;;/h1-3,6H,5H2;;/q-2;2*+1 |
| InChIKey | WADHNKFMZMIQOB-UHFFFAOYSA-N |
| XLogP | -3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.78 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;1-(chloromethyl)-3-(fluoromethyl)benzene-2-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;1-(chloromethyl)-3-(fluoromethyl)benzene-2-ide?
The IUPAC name of dipotassium;1-(chloromethyl)-3-(fluoromethyl)benzene-2-ide (CID 177360349) is dipotassium;1-(chloromethyl)-3-(fluoromethyl)benzene-2-ide.
What is the SMILES notation for dipotassium;1-(chloromethyl)-3-(fluoromethyl)benzene-2-ide?
The canonical SMILES for dipotassium;1-(chloromethyl)-3-(fluoromethyl)benzene-2-ide is F[CH-]c1[c-]c(CCl)ccc1.[K+].[K+].
What is the InChIKey of dipotassium;1-(chloromethyl)-3-(fluoromethyl)benzene-2-ide?
The InChIKey is WADHNKFMZMIQOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClF.2K/c9-5-7-2-1-3-8(4-7)6-10;;/h1-3,6H,5H2;;/q-2;2*+1.
What are the key properties of dipotassium;1-(chloromethyl)-3-(fluoromethyl)benzene-2-ide?
dipotassium;1-(chloromethyl)-3-(fluoromethyl)benzene-2-ide has a molecular weight of 234.78 g/mol, XLogP of -3.29, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;1-(chloromethyl)-3-(fluoromethyl)benzene-2-ide is sourced from PubChem (CID 177360349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).