C16H19N3O — CID 177360630
(1R,4R)-4-(1,5-dimethylpyrazol-4-yl)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde (PubChem CID 177360630) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is (1R,4R)-4-(1,5-dimethylpyrazol-4-yl)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde.
| Compound Name | (1R,4R)-4-(1,5-dimethylpyrazol-4-yl)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 177360630 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | (1R,4R)-4-(1,5-dimethylpyrazol-4-yl)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
| SMILES | Cc1c([C@@H]2CN(C=O)[C@H](C)c3ccccc32)cnn1C |
| InChI | InChI=1S/C16H19N3O/c1-11-15(8-17-18(11)3)16-9-19(10-20)12(2)13-6-4-5-7-14(13)16/h4-8,10,12,16H,9H2,1-3H3/t12-,16-/m1/s1 |
| InChIKey | RMCSFBDBXJFHIG-MLGOLLRUSA-N |
| XLogP | 2.39 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|