C24H44N6 — CID 177361517
N-[(Z)-1-(butyldiazenyl)but-1-enyl]-1-[4,6-dimethyl-5-(2-methylpropyl)-1,2-dihydropyrimidin-2-yl]-N-methylpiperidin-4-amine (PubChem CID 177361517) has the molecular formula C24H44N6 and a molecular weight of 416.66 g/mol. Its IUPAC name is N-[(Z)-1-(butyldiazenyl)but-1-enyl]-1-[4,6-dimethyl-5-(2-methylpropyl)-1,2-dihydropyrimidin-2-yl]-N-methylpiperidin-4-amine.
| Compound Name | N-[(Z)-1-(butyldiazenyl)but-1-enyl]-1-[4,6-dimethyl-5-(2-methylpropyl)-1,2-dihydropyrimidin-2-yl]-N-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 177361517 |
| Molecular Formula | C24H44N6 |
| Molecular Weight | 416.66 g/mol |
| Exact Mass | 416.36 |
| IUPAC Name | N-[(Z)-1-(butyldiazenyl)but-1-enyl]-1-[4,6-dimethyl-5-(2-methylpropyl)-1,2-dihydropyrimidin-2-yl]-N-methylpiperidin-4-amine |
| SMILES | CC/C=C(\N=N\CCCC)N(C)C1CCN(C2N=C(C)C(CC(C)C)=C(C)N2)CC1 |
| InChI | InChI=1S/C24H44N6/c1-8-10-14-25-28-23(11-9-2)29(7)21-12-15-30(16-13-21)24-26-19(5)22(17-18(3)4)20(6)27-24/h11,18,21,24,26H,8-10,12-17H2,1-7H3/b23-11+,28-25+ |
| InChIKey | YJTPRGAGAFVVBD-CSUSDLTISA-N |
| XLogP | 5.55 |
| TPSA | 55.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.66 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|