C9H13ClN4O2 — CID 177361707
5-[amino(methyl)amino]-4-chloro-2-(oxetan-3-ylmethyl)pyridazin-3-one (PubChem CID 177361707) has the molecular formula C9H13ClN4O2 and a molecular weight of 244.68 g/mol. Its IUPAC name is 5-[amino(methyl)amino]-4-chloro-2-(oxetan-3-ylmethyl)pyridazin-3-one.
| Compound Name | 5-[amino(methyl)amino]-4-chloro-2-(oxetan-3-ylmethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 177361707 |
| Molecular Formula | C9H13ClN4O2 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 5-[amino(methyl)amino]-4-chloro-2-(oxetan-3-ylmethyl)pyridazin-3-one |
| SMILES | CN(N)c1cnn(CC2COC2)c(=O)c1Cl |
| InChI | InChI=1S/C9H13ClN4O2/c1-13(11)7-2-12-14(9(15)8(7)10)3-6-4-16-5-6/h2,6H,3-5,11H2,1H3 |
| InChIKey | JJVGNGIKCBYHQL-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|