About 5,8-dimethylnon-8-en-4-one;1-(2-ethyl-3-piperazin-1-ylphenyl)butan-1-one
5,8-dimethylnon-8-en-4-one;1-(2-ethyl-3-piperazin-1-ylphenyl)butan-1-one (PubChem CID 177362323) has the molecular formula C27H44N2O2
and a molecular weight of 428.66 g/mol. Its IUPAC name is 5,8-dimethylnon-8-en-4-one;1-(2-ethyl-3-piperazin-1-ylphenyl)butan-1-one.
Molecular Properties
| Compound Name | 5,8-dimethylnon-8-en-4-one;1-(2-ethyl-3-piperazin-1-ylphenyl)butan-1-one |
| PubChem CID | 177362323 |
| Molecular Formula | C27H44N2O2 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.34 |
| IUPAC Name | 5,8-dimethylnon-8-en-4-one;1-(2-ethyl-3-piperazin-1-ylphenyl)butan-1-one |
| SMILES | C=C(C)CCC(C)C(=O)CCC.CCCC(=O)c1cccc(N2CCNCC2)c1CC |
| InChI | InChI=1S/C16H24N2O.C11H20O/c1-3-6-16(19)14-7-5-8-15(13(14)4-2)18-11-9-17-10-12-18;1-5-6-11(12)10(4)8-7-9(2)3/h5,7-8,17H,3-4,6,9-12H2,1-2H3;10H,2,5-8H2,1,3-4H3 |
| InChIKey | GUGYVEQZNMVTEW-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,8-dimethylnon-8-en-4-one;1-(2-ethyl-3-piperazin-1-ylphenyl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-dimethylnon-8-en-4-one;1-(2-ethyl-3-piperazin-1-ylphenyl)butan-1-one?
The IUPAC name of 5,8-dimethylnon-8-en-4-one;1-(2-ethyl-3-piperazin-1-ylphenyl)butan-1-one (CID 177362323) is 5,8-dimethylnon-8-en-4-one;1-(2-ethyl-3-piperazin-1-ylphenyl)butan-1-one.
What is the SMILES notation for 5,8-dimethylnon-8-en-4-one;1-(2-ethyl-3-piperazin-1-ylphenyl)butan-1-one?
The canonical SMILES for 5,8-dimethylnon-8-en-4-one;1-(2-ethyl-3-piperazin-1-ylphenyl)butan-1-one is C=C(C)CCC(C)C(=O)CCC.CCCC(=O)c1cccc(N2CCNCC2)c1CC.
What is the InChIKey of 5,8-dimethylnon-8-en-4-one;1-(2-ethyl-3-piperazin-1-ylphenyl)butan-1-one?
The InChIKey is GUGYVEQZNMVTEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O.C11H20O/c1-3-6-16(19)14-7-5-8-15(13(14)4-2)18-11-9-17-10-12-18;1-5-6-11(12)10(4)8-7-9(2)3/h5,7-8,17H,3-4,6,9-12H2,1-2H3;10H,2,5-8H2,1,3-4H3.
What are the key properties of 5,8-dimethylnon-8-en-4-one;1-(2-ethyl-3-piperazin-1-ylphenyl)butan-1-one?
5,8-dimethylnon-8-en-4-one;1-(2-ethyl-3-piperazin-1-ylphenyl)butan-1-one has a molecular weight of 428.66 g/mol, XLogP of 5.99, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dimethylnon-8-en-4-one;1-(2-ethyl-3-piperazin-1-ylphenyl)butan-1-one is sourced from PubChem (CID 177362323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).