C10H17N3 — CID 177362769
2-propyl-1,4,5,6,7,8-hexahydropyrido[3,4-d]pyrimidine (PubChem CID 177362769) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 2-propyl-1,4,5,6,7,8-hexahydropyrido[3,4-d]pyrimidine.
| Compound Name | 2-propyl-1,4,5,6,7,8-hexahydropyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 177362769 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 2-propyl-1,4,5,6,7,8-hexahydropyrido[3,4-d]pyrimidine |
| SMILES | CCCC1=NCC2=C(CNCC2)N1 |
| InChI | InChI=1S/C10H17N3/c1-2-3-10-12-6-8-4-5-11-7-9(8)13-10/h11H,2-7H2,1H3,(H,12,13) |
| InChIKey | LSYJDNYDAGSVFS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |