C16H21NO2 — CID 177363122
1-imino-5-[(3E,5Z)-6-methylocta-1,3,5,7-tetraen-3-yl]heptane-2,6-dione (PubChem CID 177363122) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-imino-5-[(3E,5Z)-6-methylocta-1,3,5,7-tetraen-3-yl]heptane-2,6-dione.
| Compound Name | 1-imino-5-[(3E,5Z)-6-methylocta-1,3,5,7-tetraen-3-yl]heptane-2,6-dione |
|---|---|
| PubChem CID | 177363122 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 1-imino-5-[(3E,5Z)-6-methylocta-1,3,5,7-tetraen-3-yl]heptane-2,6-dione |
| SMILES | [H]/N=C/C(=O)CCC(C(C)=O)/C(C=C)=C/C=C(/C)C=C |
| InChI | InChI=1S/C16H21NO2/c1-5-12(3)7-8-14(6-2)16(13(4)18)10-9-15(19)11-17/h5-8,11,16-17H,1-2,9-10H2,3-4H3/b12-7-,14-8+,17-11+ |
| InChIKey | JBYMHTTZUDNEBW-YVNTUGNOSA-N |
| XLogP | 3.44 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|