About CID 177364126
CID 177364126 (PubChem CID 177364126) has the molecular formula C15H26NO
and a molecular weight of 236.38 g/mol.
Molecular Properties
| Compound Name | CID 177364126 |
| PubChem CID | 177364126 |
| Molecular Formula | C15H26NO |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C.O=C(CN1CCCCC1)C1=C[CH]1 |
| InChI | InChI=1S/C10H14NO.C5H12/c12-10(9-4-5-9)8-11-6-2-1-3-7-11;1-5(2,3)4/h4-5H,1-3,6-8H2;1-4H3 |
| InChIKey | HVVCIOQADFIDPS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 177364126 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177364126?
The IUPAC name of CID 177364126 (CID 177364126) is not available.
What is the SMILES notation for CID 177364126?
The canonical SMILES for CID 177364126 is CC(C)(C)C.O=C(CN1CCCCC1)C1=C[CH]1.
What is the InChIKey of CID 177364126?
The InChIKey is HVVCIOQADFIDPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14NO.C5H12/c12-10(9-4-5-9)8-11-6-2-1-3-7-11;1-5(2,3)4/h4-5H,1-3,6-8H2;1-4H3.
What are the key properties of CID 177364126?
CID 177364126 has a molecular weight of 236.38 g/mol, XLogP of 3.24, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177364126 is sourced from PubChem (CID 177364126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).