C14H28N2O — CID 177364927
[(2S,5R)-5-[(2Z,4Z)-5-aminohepta-2,4-dien-4-yl]pyrrolidin-2-yl]methanol;ethane (PubChem CID 177364927) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is [(2S,5R)-5-[(2Z,4Z)-5-aminohepta-2,4-dien-4-yl]pyrrolidin-2-yl]methanol;ethane.
| Compound Name | [(2S,5R)-5-[(2Z,4Z)-5-aminohepta-2,4-dien-4-yl]pyrrolidin-2-yl]methanol;ethane |
|---|---|
| PubChem CID | 177364927 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | [(2S,5R)-5-[(2Z,4Z)-5-aminohepta-2,4-dien-4-yl]pyrrolidin-2-yl]methanol;ethane |
| SMILES | C/C=C\C(=C(\N)CC)[C@H]1CC[C@@H](CO)N1.CC |
| InChI | InChI=1S/C12H22N2O.C2H6/c1-3-5-10(11(13)4-2)12-7-6-9(8-15)14-12;1-2/h3,5,9,12,14-15H,4,6-8,13H2,1-2H3;1-2H3/b5-3-,11-10-;/t9-,12+;/m0./s1 |
| InChIKey | SSFQVIGJYXSGSM-WADGITAWSA-N |
| XLogP | 2.32 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|