About methanol;[(2S,5R)-5-(2-methylpyrazol-3-yl)pyrrolidin-2-yl]methanol
methanol;[(2S,5R)-5-(2-methylpyrazol-3-yl)pyrrolidin-2-yl]methanol (PubChem CID 177365006) has the molecular formula C11H23N3O3
and a molecular weight of 245.32 g/mol. Its IUPAC name is methanol;[(2S,5R)-5-(2-methylpyrazol-3-yl)pyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | methanol;[(2S,5R)-5-(2-methylpyrazol-3-yl)pyrrolidin-2-yl]methanol |
| PubChem CID | 177365006 |
| Molecular Formula | C11H23N3O3 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | methanol;[(2S,5R)-5-(2-methylpyrazol-3-yl)pyrrolidin-2-yl]methanol |
| SMILES | CO.CO.Cn1nccc1[C@H]1CC[C@@H](CO)N1 |
| InChI | InChI=1S/C9H15N3O.2CH4O/c1-12-9(4-5-10-12)8-3-2-7(6-13)11-8;2*1-2/h4-5,7-8,11,13H,2-3,6H2,1H3;2*2H,1H3/t7-,8+;;/m0../s1 |
| InChIKey | RCQUWHXXOLBYBK-OXOJUWDDSA-N |
| XLogP | -0.58 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methanol;[(2S,5R)-5-(2-methylpyrazol-3-yl)pyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;[(2S,5R)-5-(2-methylpyrazol-3-yl)pyrrolidin-2-yl]methanol?
The IUPAC name of methanol;[(2S,5R)-5-(2-methylpyrazol-3-yl)pyrrolidin-2-yl]methanol (CID 177365006) is methanol;[(2S,5R)-5-(2-methylpyrazol-3-yl)pyrrolidin-2-yl]methanol.
What is the SMILES notation for methanol;[(2S,5R)-5-(2-methylpyrazol-3-yl)pyrrolidin-2-yl]methanol?
The canonical SMILES for methanol;[(2S,5R)-5-(2-methylpyrazol-3-yl)pyrrolidin-2-yl]methanol is CO.CO.Cn1nccc1[C@H]1CC[C@@H](CO)N1.
What is the InChIKey of methanol;[(2S,5R)-5-(2-methylpyrazol-3-yl)pyrrolidin-2-yl]methanol?
The InChIKey is RCQUWHXXOLBYBK-OXOJUWDDSA-N. The full InChI is InChI=1S/C9H15N3O.2CH4O/c1-12-9(4-5-10-12)8-3-2-7(6-13)11-8;2*1-2/h4-5,7-8,11,13H,2-3,6H2,1H3;2*2H,1H3/t7-,8+;;/m0../s1.
What are the key properties of methanol;[(2S,5R)-5-(2-methylpyrazol-3-yl)pyrrolidin-2-yl]methanol?
methanol;[(2S,5R)-5-(2-methylpyrazol-3-yl)pyrrolidin-2-yl]methanol has a molecular weight of 245.32 g/mol, XLogP of -0.58, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;[(2S,5R)-5-(2-methylpyrazol-3-yl)pyrrolidin-2-yl]methanol is sourced from PubChem (CID 177365006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).