C20H25N — CID 177365049
N,5-diethyl-2-(1,2,3,4-tetrahydronaphthalen-2-yl)aniline (PubChem CID 177365049) has the molecular formula C20H25N and a molecular weight of 279.43 g/mol. Its IUPAC name is N,5-diethyl-2-(1,2,3,4-tetrahydronaphthalen-2-yl)aniline.
| Compound Name | N,5-diethyl-2-(1,2,3,4-tetrahydronaphthalen-2-yl)aniline |
|---|---|
| PubChem CID | 177365049 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | N,5-diethyl-2-(1,2,3,4-tetrahydronaphthalen-2-yl)aniline |
| SMILES | CCNc1cc(CC)ccc1C1CCc2ccccc2C1 |
| InChI | InChI=1S/C20H25N/c1-3-15-9-12-19(20(13-15)21-4-2)18-11-10-16-7-5-6-8-17(16)14-18/h5-9,12-13,18,21H,3-4,10-11,14H2,1-2H3 |
| InChIKey | HAIQVGJTRFIVBF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |