C18H22BrFN4O4 — CID 177365282
1-O-tert-butyl 2-O-methyl (2S,4R)-4-azido-2-[(3-bromo-4-fluorophenyl)methyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 177365282) has the molecular formula C18H22BrFN4O4 and a molecular weight of 457.30 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4R)-4-azido-2-[(3-bromo-4-fluorophenyl)methyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-azido-2-[(3-bromo-4-fluorophenyl)methyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 177365282 |
| Molecular Formula | C18H22BrFN4O4 |
| Molecular Weight | 457.30 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-azido-2-[(3-bromo-4-fluorophenyl)methyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@]1(Cc2ccc(F)c(Br)c2)C[C@@H](N=[N+]=[N-])CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H22BrFN4O4/c1-17(2,3)28-16(26)24-10-12(22-23-21)9-18(24,15(25)27-4)8-11-5-6-14(20)13(19)7-11/h5-7,12H,8-10H2,1-4H3/t12-,18+/m1/s1 |
| InChIKey | JXWFLWRLCSIHIK-XIKOKIGWSA-N |
| XLogP | 4.36 |
| TPSA | 104.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.30 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|