C27H24ClFN3OP — CID 177367107
(1R)-18-chloro-5-(4-dimethylphosphanyl-3-fluorophenyl)-12,15-dimethyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one (PubChem CID 177367107) has the molecular formula C27H24ClFN3OP and a molecular weight of 491.93 g/mol. Its IUPAC name is (1R)-18-chloro-5-(4-dimethylphosphanyl-3-fluorophenyl)-12,15-dimethyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one.
| Compound Name | (1R)-18-chloro-5-(4-dimethylphosphanyl-3-fluorophenyl)-12,15-dimethyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one |
|---|---|
| PubChem CID | 177367107 |
| Molecular Formula | C27H24ClFN3OP |
| Molecular Weight | 491.93 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | (1R)-18-chloro-5-(4-dimethylphosphanyl-3-fluorophenyl)-12,15-dimethyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one |
| SMILES | Cc1ccc(Cl)c2c1C(=O)N(C)C1C[C@H]2n2c1nc1ccc(-c3ccc(P(C)C)c(F)c3)cc12 |
| InChI | InChI=1S/C27H24ClFN3OP/c1-14-5-8-17(28)25-21-13-22(31(2)27(33)24(14)25)26-30-19-9-6-16(12-20(19)32(21)26)15-7-10-23(34(3)4)18(29)11-15/h5-12,21-22H,13H2,1-4H3/t21-,22?/m1/s1 |
| InChIKey | JOAUBUSTEPVWKF-ZMFCMNQTSA-N |
| XLogP | 6.29 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.93 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|