C17H22F3N3O3 — CID 177368559
tert-butyl N-[5-amino-1-(2,2,2-trifluoroethylcarbamoyl)-2,3-dihydroinden-1-yl]carbamate (PubChem CID 177368559) has the molecular formula C17H22F3N3O3 and a molecular weight of 373.38 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-(2,2,2-trifluoroethylcarbamoyl)-2,3-dihydroinden-1-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-(2,2,2-trifluoroethylcarbamoyl)-2,3-dihydroinden-1-yl]carbamate |
|---|---|
| PubChem CID | 177368559 |
| Molecular Formula | C17H22F3N3O3 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | tert-butyl N-[5-amino-1-(2,2,2-trifluoroethylcarbamoyl)-2,3-dihydroinden-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(C(=O)NCC(F)(F)F)CCc2cc(N)ccc21 |
| InChI | InChI=1S/C17H22F3N3O3/c1-15(2,3)26-14(25)23-16(13(24)22-9-17(18,19)20)7-6-10-8-11(21)4-5-12(10)16/h4-5,8H,6-7,9,21H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | OCAGHMZTKPSCJQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|