About CID 177369116
CID 177369116 (PubChem CID 177369116) has the molecular formula C29H22B3ClFN9O
and a molecular weight of 599.44 g/mol.
Molecular Properties
| Compound Name | CID 177369116 |
| PubChem CID | 177369116 |
| Molecular Formula | C29H22B3ClFN9O |
| Molecular Weight | 599.44 g/mol |
| Exact Mass | 599.19 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])n1nc(-c2ccc(-c3cncc(Cl)c3)c3c(N4CCN(C(=O)C(F)(C#N)C5CC5)C(C)C4)ncnc23)cc1C#N |
| InChI | InChI=1S/C29H22B3ClFN9O/c1-16-13-41(6-7-42(16)27(44)28(34,14-36)18-2-3-18)26-24-21(17-8-19(33)12-37-11-17)4-5-22(25(24)38-15-39-26)23-9-20(10-35)43(40-23)29(30,31)32/h4-5,8-9,11-12,15-16,18H,2-3,6-7,13H2,1H3 |
| InChIKey | QDBCNMFTTHUSDL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 127.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 599.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 177369116 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177369116?
The IUPAC name of CID 177369116 (CID 177369116) is not available.
What is the SMILES notation for CID 177369116?
The canonical SMILES for CID 177369116 is [B]C([B])([B])n1nc(-c2ccc(-c3cncc(Cl)c3)c3c(N4CCN(C(=O)C(F)(C#N)C5CC5)C(C)C4)ncnc23)cc1C#N.
What is the InChIKey of CID 177369116?
The InChIKey is QDBCNMFTTHUSDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H22B3ClFN9O/c1-16-13-41(6-7-42(16)27(44)28(34,14-36)18-2-3-18)26-24-21(17-8-19(33)12-37-11-17)4-5-22(25(24)38-15-39-26)23-9-20(10-35)43(40-23)29(30,31)32/h4-5,8-9,11-12,15-16,18H,2-3,6-7,13H2,1H3.
What are the key properties of CID 177369116?
CID 177369116 has a molecular weight of 599.44 g/mol, XLogP of 2.83, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177369116 is sourced from PubChem (CID 177369116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).