About ethane;5-fluoro-2,3,4-trimethylpyridine
ethane;5-fluoro-2,3,4-trimethylpyridine (PubChem CID 177369282) has the molecular formula C10H16FN
and a molecular weight of 169.24 g/mol. Its IUPAC name is ethane;5-fluoro-2,3,4-trimethylpyridine.
Molecular Properties
| Compound Name | ethane;5-fluoro-2,3,4-trimethylpyridine |
| PubChem CID | 177369282 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | ethane;5-fluoro-2,3,4-trimethylpyridine |
| SMILES | CC.Cc1ncc(F)c(C)c1C |
| InChI | InChI=1S/C8H10FN.C2H6/c1-5-6(2)8(9)4-10-7(5)3;1-2/h4H,1-3H3;1-2H3 |
| InChIKey | GVVQJXLHKCZCRH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;5-fluoro-2,3,4-trimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-fluoro-2,3,4-trimethylpyridine?
The IUPAC name of ethane;5-fluoro-2,3,4-trimethylpyridine (CID 177369282) is ethane;5-fluoro-2,3,4-trimethylpyridine.
What is the SMILES notation for ethane;5-fluoro-2,3,4-trimethylpyridine?
The canonical SMILES for ethane;5-fluoro-2,3,4-trimethylpyridine is CC.Cc1ncc(F)c(C)c1C.
What is the InChIKey of ethane;5-fluoro-2,3,4-trimethylpyridine?
The InChIKey is GVVQJXLHKCZCRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FN.C2H6/c1-5-6(2)8(9)4-10-7(5)3;1-2/h4H,1-3H3;1-2H3.
What are the key properties of ethane;5-fluoro-2,3,4-trimethylpyridine?
ethane;5-fluoro-2,3,4-trimethylpyridine has a molecular weight of 169.24 g/mol, XLogP of 3.17, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-fluoro-2,3,4-trimethylpyridine is sourced from PubChem (CID 177369282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).