About 5-ethyl-1,3-dioxol-4-amine
5-ethyl-1,3-dioxol-4-amine (PubChem CID 177369295) has the molecular formula C5H9NO2
and a molecular weight of 115.13 g/mol. Its IUPAC name is 5-ethyl-1,3-dioxol-4-amine.
Molecular Properties
| Compound Name | 5-ethyl-1,3-dioxol-4-amine |
| PubChem CID | 177369295 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | 5-ethyl-1,3-dioxol-4-amine |
| SMILES | CCC1=C(N)OCO1 |
| InChI | InChI=1S/C5H9NO2/c1-2-4-5(6)8-3-7-4/h2-3,6H2,1H3 |
| InChIKey | AAOIMQYNTWXLSO-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethyl-1,3-dioxol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1,3-dioxol-4-amine?
The IUPAC name of 5-ethyl-1,3-dioxol-4-amine (CID 177369295) is 5-ethyl-1,3-dioxol-4-amine.
What is the SMILES notation for 5-ethyl-1,3-dioxol-4-amine?
The canonical SMILES for 5-ethyl-1,3-dioxol-4-amine is CCC1=C(N)OCO1.
What is the InChIKey of 5-ethyl-1,3-dioxol-4-amine?
The InChIKey is AAOIMQYNTWXLSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2/c1-2-4-5(6)8-3-7-4/h2-3,6H2,1H3.
What are the key properties of 5-ethyl-1,3-dioxol-4-amine?
5-ethyl-1,3-dioxol-4-amine has a molecular weight of 115.13 g/mol, XLogP of 0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1,3-dioxol-4-amine is sourced from PubChem (CID 177369295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).