About 3-[2-(methoxymethoxy)-6-methyl-4-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-c]pyridazine
3-[2-(methoxymethoxy)-6-methyl-4-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-c]pyridazine (PubChem CID 177370353) has the molecular formula C16H14F3N3O2
and a molecular weight of 337.30 g/mol. Its IUPAC name is 3-[2-(methoxymethoxy)-6-methyl-4-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-c]pyridazine.
Molecular Properties
| Compound Name | 3-[2-(methoxymethoxy)-6-methyl-4-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-c]pyridazine |
| PubChem CID | 177370353 |
| Molecular Formula | C16H14F3N3O2 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 3-[2-(methoxymethoxy)-6-methyl-4-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-c]pyridazine |
| SMILES | COCOc1cc(C(F)(F)F)cc(C)c1-c1cc2cc[nH]c2nn1 |
| InChI | InChI=1S/C16H14F3N3O2/c1-9-5-11(16(17,18)19)7-13(24-8-23-2)14(9)12-6-10-3-4-20-15(10)22-21-12/h3-7H,8H2,1-2H3,(H,20,22) |
| InChIKey | YEVQECKWJAVHJZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(methoxymethoxy)-6-methyl-4-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(methoxymethoxy)-6-methyl-4-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-c]pyridazine?
The IUPAC name of 3-[2-(methoxymethoxy)-6-methyl-4-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-c]pyridazine (CID 177370353) is 3-[2-(methoxymethoxy)-6-methyl-4-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-c]pyridazine.
What is the SMILES notation for 3-[2-(methoxymethoxy)-6-methyl-4-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-c]pyridazine?
The canonical SMILES for 3-[2-(methoxymethoxy)-6-methyl-4-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-c]pyridazine is COCOc1cc(C(F)(F)F)cc(C)c1-c1cc2cc[nH]c2nn1.
What is the InChIKey of 3-[2-(methoxymethoxy)-6-methyl-4-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-c]pyridazine?
The InChIKey is YEVQECKWJAVHJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F3N3O2/c1-9-5-11(16(17,18)19)7-13(24-8-23-2)14(9)12-6-10-3-4-20-15(10)22-21-12/h3-7H,8H2,1-2H3,(H,20,22).
What are the key properties of 3-[2-(methoxymethoxy)-6-methyl-4-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-c]pyridazine?
3-[2-(methoxymethoxy)-6-methyl-4-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-c]pyridazine has a molecular weight of 337.30 g/mol, XLogP of 3.93, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(methoxymethoxy)-6-methyl-4-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-c]pyridazine is sourced from PubChem (CID 177370353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).