C25H19ClF3NO4S — CID 177370435
2-chloro-4-[(E)-2-(1-methylquinolin-1-ium-2-yl)ethenyl]phenol;4-(trifluoromethyl)benzenesulfonate (PubChem CID 177370435) has the molecular formula C25H19ClF3NO4S and a molecular weight of 521.94 g/mol. Its IUPAC name is 2-chloro-4-[(E)-2-(1-methylquinolin-1-ium-2-yl)ethenyl]phenol;4-(trifluoromethyl)benzenesulfonate.
| Compound Name | 2-chloro-4-[(E)-2-(1-methylquinolin-1-ium-2-yl)ethenyl]phenol;4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 177370435 |
| Molecular Formula | C25H19ClF3NO4S |
| Molecular Weight | 521.94 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | 2-chloro-4-[(E)-2-(1-methylquinolin-1-ium-2-yl)ethenyl]phenol;4-(trifluoromethyl)benzenesulfonate |
| SMILES | C[n+]1c(/C=C/c2ccc(O)c(Cl)c2)ccc2ccccc21.O=S(=O)([O-])c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H14ClNO.C7H5F3O3S/c1-20-15(10-8-14-4-2-3-5-17(14)20)9-6-13-7-11-18(21)16(19)12-13;8-7(9,10)5-1-3-6(4-2-5)14(11,12)13/h2-12H,1H3;1-4H,(H,11,12,13) |
| InChIKey | PJOYLTHEGVKIJM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.94 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|