About S-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl] piperidine-1-carbothioate
S-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl] piperidine-1-carbothioate (PubChem CID 177370886) has the molecular formula C18H19NO3S
and a molecular weight of 329.42 g/mol. Its IUPAC name is S-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl] piperidine-1-carbothioate.
Molecular Properties
| Compound Name | S-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl] piperidine-1-carbothioate |
| PubChem CID | 177370886 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | S-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl] piperidine-1-carbothioate |
| SMILES | CC1=C(CSC(=O)N2CCCCC2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H19NO3S/c1-12-15(11-23-18(22)19-9-5-2-6-10-19)17(21)14-8-4-3-7-13(14)16(12)20/h3-4,7-8H,2,5-6,9-11H2,1H3 |
| InChIKey | OACYUUCFLGIXJS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl] piperidine-1-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl] piperidine-1-carbothioate?
The IUPAC name of S-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl] piperidine-1-carbothioate (CID 177370886) is S-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl] piperidine-1-carbothioate.
What is the SMILES notation for S-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl] piperidine-1-carbothioate?
The canonical SMILES for S-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl] piperidine-1-carbothioate is CC1=C(CSC(=O)N2CCCCC2)C(=O)c2ccccc2C1=O.
What is the InChIKey of S-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl] piperidine-1-carbothioate?
The InChIKey is OACYUUCFLGIXJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3S/c1-12-15(11-23-18(22)19-9-5-2-6-10-19)17(21)14-8-4-3-7-13(14)16(12)20/h3-4,7-8H,2,5-6,9-11H2,1H3.
What are the key properties of S-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl] piperidine-1-carbothioate?
S-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl] piperidine-1-carbothioate has a molecular weight of 329.42 g/mol, XLogP of 3.72, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl] piperidine-1-carbothioate is sourced from PubChem (CID 177370886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).