C40H62N2O8 — CID 177371029
[(2R,3S,10Z,13Z,16Z,19Z,21E,25Z,28S,29R)-2,29-diacetamido-23,28-diacetyloxytriaconta-10,13,16,19,21,25-hexaen-3-yl] acetate (PubChem CID 177371029) has the molecular formula C40H62N2O8 and a molecular weight of 698.94 g/mol. Its IUPAC name is [(2R,3S,10Z,13Z,16Z,19Z,21E,25Z,28S,29R)-2,29-diacetamido-23,28-diacetyloxytriaconta-10,13,16,19,21,25-hexaen-3-yl] acetate.
| Compound Name | [(2R,3S,10Z,13Z,16Z,19Z,21E,25Z,28S,29R)-2,29-diacetamido-23,28-diacetyloxytriaconta-10,13,16,19,21,25-hexaen-3-yl] acetate |
|---|---|
| PubChem CID | 177371029 |
| Molecular Formula | C40H62N2O8 |
| Molecular Weight | 698.94 g/mol |
| Exact Mass | 698.45 |
| IUPAC Name | [(2R,3S,10Z,13Z,16Z,19Z,21E,25Z,28S,29R)-2,29-diacetamido-23,28-diacetyloxytriaconta-10,13,16,19,21,25-hexaen-3-yl] acetate |
| SMILES | CC(=O)N[C@H](C)[C@H](C/C=C\CC(/C=C/C=C\C/C=C\C/C=C\C/C=C\CCCCCC[C@H](OC(C)=O)[C@@H](C)NC(C)=O)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C40H62N2O8/c1-31(41-33(3)43)39(49-36(6)46)29-24-22-20-18-16-14-12-10-8-9-11-13-15-17-19-21-23-27-38(48-35(5)45)28-25-26-30-40(50-37(7)47)32(2)42-34(4)44/h8-9,12-15,19,21,23,25-27,31-32,38-40H,10-11,16-18,20,22,24,28-30H2,1-7H3,(H,41,43)(H,42,44)/b9-8-,14-12-,15-13-,21-19-,26-25-,27-23+/t31-,32-,38?,39+,40+/m1/s1 |
| InChIKey | TZLZULJBQPWFKW-PJLPSUOQSA-N |
| XLogP | 7.46 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.94 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|