C17H18N4O7S2 — CID 177371156
(5Z)-3-[2-(4-methylsulfonylpiperazin-1-yl)acetyl]-5-[(4-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 177371156) has the molecular formula C17H18N4O7S2 and a molecular weight of 454.49 g/mol. Its IUPAC name is (5Z)-3-[2-(4-methylsulfonylpiperazin-1-yl)acetyl]-5-[(4-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[2-(4-methylsulfonylpiperazin-1-yl)acetyl]-5-[(4-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 177371156 |
| Molecular Formula | C17H18N4O7S2 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | (5Z)-3-[2-(4-methylsulfonylpiperazin-1-yl)acetyl]-5-[(4-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CS(=O)(=O)N1CCN(CC(=O)N2C(=O)S/C(=C\c3ccc([N+](=O)[O-])cc3)C2=O)CC1 |
| InChI | InChI=1S/C17H18N4O7S2/c1-30(27,28)19-8-6-18(7-9-19)11-15(22)20-16(23)14(29-17(20)24)10-12-2-4-13(5-3-12)21(25)26/h2-5,10H,6-9,11H2,1H3/b14-10- |
| InChIKey | QKEOQAIKUKILIZ-UVTDQMKNSA-N |
| XLogP | 0.73 |
| TPSA | 138.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|