About (2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoroindol-1-yl)propan-2-ol
(2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoroindol-1-yl)propan-2-ol (PubChem CID 177371293) has the molecular formula C20H21FN2O
and a molecular weight of 324.40 g/mol. Its IUPAC name is (2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoroindol-1-yl)propan-2-ol.
Molecular Properties
| Compound Name | (2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoroindol-1-yl)propan-2-ol |
| PubChem CID | 177371293 |
| Molecular Formula | C20H21FN2O |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoroindol-1-yl)propan-2-ol |
| SMILES | O[C@H](CN1CCc2ccccc2C1)Cn1ccc2cc(F)ccc21 |
| InChI | InChI=1S/C20H21FN2O/c21-18-5-6-20-16(11-18)8-10-23(20)14-19(24)13-22-9-7-15-3-1-2-4-17(15)12-22/h1-6,8,10-11,19,24H,7,9,12-14H2/t19-/m1/s1 |
| InChIKey | QZQCHSUCFKTFEP-LJQANCHMSA-N |
| XLogP | 3.20 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoroindol-1-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoroindol-1-yl)propan-2-ol?
The IUPAC name of (2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoroindol-1-yl)propan-2-ol (CID 177371293) is (2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoroindol-1-yl)propan-2-ol.
What is the SMILES notation for (2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoroindol-1-yl)propan-2-ol?
The canonical SMILES for (2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoroindol-1-yl)propan-2-ol is O[C@H](CN1CCc2ccccc2C1)Cn1ccc2cc(F)ccc21.
What is the InChIKey of (2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoroindol-1-yl)propan-2-ol?
The InChIKey is QZQCHSUCFKTFEP-LJQANCHMSA-N. The full InChI is InChI=1S/C20H21FN2O/c21-18-5-6-20-16(11-18)8-10-23(20)14-19(24)13-22-9-7-15-3-1-2-4-17(15)12-22/h1-6,8,10-11,19,24H,7,9,12-14H2/t19-/m1/s1.
What are the key properties of (2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoroindol-1-yl)propan-2-ol?
(2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoroindol-1-yl)propan-2-ol has a molecular weight of 324.40 g/mol, XLogP of 3.20, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoroindol-1-yl)propan-2-ol is sourced from PubChem (CID 177371293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).