C23H18Cl2N4O2 — CID 177371335
N-[2-[5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-1H-indazol-3-yl]phenyl]prop-2-enamide (PubChem CID 177371335) has the molecular formula C23H18Cl2N4O2 and a molecular weight of 453.33 g/mol. Its IUPAC name is N-[2-[5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-1H-indazol-3-yl]phenyl]prop-2-enamide.
| Compound Name | N-[2-[5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-1H-indazol-3-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 177371335 |
| Molecular Formula | C23H18Cl2N4O2 |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | N-[2-[5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-1H-indazol-3-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1-c1n[nH]c2ccc(O[C@H](C)c3c(Cl)cncc3Cl)cc12 |
| InChI | InChI=1S/C23H18Cl2N4O2/c1-3-21(30)27-19-7-5-4-6-15(19)23-16-10-14(8-9-20(16)28-29-23)31-13(2)22-17(24)11-26-12-18(22)25/h3-13H,1H2,2H3,(H,27,30)(H,28,29)/t13-/m1/s1 |
| InChIKey | LMXVXVRNOOYSEV-CYBMUJFWSA-N |
| XLogP | 6.20 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|