About 4-[4-[(2,6-dichlorophenyl)sulfonyl-(2-methylpropyl)amino]phenyl]benzamide
4-[4-[(2,6-dichlorophenyl)sulfonyl-(2-methylpropyl)amino]phenyl]benzamide (PubChem CID 177371410) has the molecular formula C23H22Cl2N2O3S
and a molecular weight of 477.41 g/mol. Its IUPAC name is 4-[4-[(2,6-dichlorophenyl)sulfonyl-(2-methylpropyl)amino]phenyl]benzamide.
Molecular Properties
| Compound Name | 4-[4-[(2,6-dichlorophenyl)sulfonyl-(2-methylpropyl)amino]phenyl]benzamide |
| PubChem CID | 177371410 |
| Molecular Formula | C23H22Cl2N2O3S |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 4-[4-[(2,6-dichlorophenyl)sulfonyl-(2-methylpropyl)amino]phenyl]benzamide |
| SMILES | CC(C)CN(c1ccc(-c2ccc(C(N)=O)cc2)cc1)S(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H22Cl2N2O3S/c1-15(2)14-27(31(29,30)22-20(24)4-3-5-21(22)25)19-12-10-17(11-13-19)16-6-8-18(9-7-16)23(26)28/h3-13,15H,14H2,1-2H3,(H2,26,28) |
| InChIKey | OCTZUZLBQOPICL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4-[(2,6-dichlorophenyl)sulfonyl-(2-methylpropyl)amino]phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(2,6-dichlorophenyl)sulfonyl-(2-methylpropyl)amino]phenyl]benzamide?
The IUPAC name of 4-[4-[(2,6-dichlorophenyl)sulfonyl-(2-methylpropyl)amino]phenyl]benzamide (CID 177371410) is 4-[4-[(2,6-dichlorophenyl)sulfonyl-(2-methylpropyl)amino]phenyl]benzamide.
What is the SMILES notation for 4-[4-[(2,6-dichlorophenyl)sulfonyl-(2-methylpropyl)amino]phenyl]benzamide?
The canonical SMILES for 4-[4-[(2,6-dichlorophenyl)sulfonyl-(2-methylpropyl)amino]phenyl]benzamide is CC(C)CN(c1ccc(-c2ccc(C(N)=O)cc2)cc1)S(=O)(=O)c1c(Cl)cccc1Cl.
What is the InChIKey of 4-[4-[(2,6-dichlorophenyl)sulfonyl-(2-methylpropyl)amino]phenyl]benzamide?
The InChIKey is OCTZUZLBQOPICL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22Cl2N2O3S/c1-15(2)14-27(31(29,30)22-20(24)4-3-5-21(22)25)19-12-10-17(11-13-19)16-6-8-18(9-7-16)23(26)28/h3-13,15H,14H2,1-2H3,(H2,26,28).
What are the key properties of 4-[4-[(2,6-dichlorophenyl)sulfonyl-(2-methylpropyl)amino]phenyl]benzamide?
4-[4-[(2,6-dichlorophenyl)sulfonyl-(2-methylpropyl)amino]phenyl]benzamide has a molecular weight of 477.41 g/mol, XLogP of 5.61, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(2,6-dichlorophenyl)sulfonyl-(2-methylpropyl)amino]phenyl]benzamide is sourced from PubChem (CID 177371410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).