C24H23FN6O4 — CID 177371740
4-[[3-[3-(1,2-dihydroxyethyl)-5-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]-4-fluorophenyl]methyl]-2H-phthalazin-1-one (PubChem CID 177371740) has the molecular formula C24H23FN6O4 and a molecular weight of 478.48 g/mol. Its IUPAC name is 4-[[3-[3-(1,2-dihydroxyethyl)-5-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]-4-fluorophenyl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[3-[3-(1,2-dihydroxyethyl)-5-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]-4-fluorophenyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 177371740 |
| Molecular Formula | C24H23FN6O4 |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 4-[[3-[3-(1,2-dihydroxyethyl)-5-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]-4-fluorophenyl]methyl]-2H-phthalazin-1-one |
| SMILES | CC1CN(C(=O)c2cc(Cc3n[nH]c(=O)c4ccccc34)ccc2F)Cc2nnc(C(O)CO)n21 |
| InChI | InChI=1S/C24H23FN6O4/c1-13-10-30(11-21-27-28-22(31(13)21)20(33)12-32)24(35)17-8-14(6-7-18(17)25)9-19-15-4-2-3-5-16(15)23(34)29-26-19/h2-8,13,20,32-33H,9-12H2,1H3,(H,29,34) |
| InChIKey | URYULUTZDQQOMQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |