About N-[6-(2,3-dimethylimidazol-4-yl)quinazolin-4-yl]-1,3-benzothiazol-5-amine
N-[6-(2,3-dimethylimidazol-4-yl)quinazolin-4-yl]-1,3-benzothiazol-5-amine (PubChem CID 177371840) has the molecular formula C20H16N6S
and a molecular weight of 372.46 g/mol. Its IUPAC name is N-[6-(2,3-dimethylimidazol-4-yl)quinazolin-4-yl]-1,3-benzothiazol-5-amine.
Molecular Properties
| Compound Name | N-[6-(2,3-dimethylimidazol-4-yl)quinazolin-4-yl]-1,3-benzothiazol-5-amine |
| PubChem CID | 177371840 |
| Molecular Formula | C20H16N6S |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N-[6-(2,3-dimethylimidazol-4-yl)quinazolin-4-yl]-1,3-benzothiazol-5-amine |
| SMILES | Cc1ncc(-c2ccc3ncnc(Nc4ccc5scnc5c4)c3c2)n1C |
| InChI | InChI=1S/C20H16N6S/c1-12-21-9-18(26(12)2)13-3-5-16-15(7-13)20(23-10-22-16)25-14-4-6-19-17(8-14)24-11-27-19/h3-11H,1-2H3,(H,22,23,25) |
| InChIKey | SKECELGCEOIMAK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[6-(2,3-dimethylimidazol-4-yl)quinazolin-4-yl]-1,3-benzothiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(2,3-dimethylimidazol-4-yl)quinazolin-4-yl]-1,3-benzothiazol-5-amine?
The IUPAC name of N-[6-(2,3-dimethylimidazol-4-yl)quinazolin-4-yl]-1,3-benzothiazol-5-amine (CID 177371840) is N-[6-(2,3-dimethylimidazol-4-yl)quinazolin-4-yl]-1,3-benzothiazol-5-amine.
What is the SMILES notation for N-[6-(2,3-dimethylimidazol-4-yl)quinazolin-4-yl]-1,3-benzothiazol-5-amine?
The canonical SMILES for N-[6-(2,3-dimethylimidazol-4-yl)quinazolin-4-yl]-1,3-benzothiazol-5-amine is Cc1ncc(-c2ccc3ncnc(Nc4ccc5scnc5c4)c3c2)n1C.
What is the InChIKey of N-[6-(2,3-dimethylimidazol-4-yl)quinazolin-4-yl]-1,3-benzothiazol-5-amine?
The InChIKey is SKECELGCEOIMAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N6S/c1-12-21-9-18(26(12)2)13-3-5-16-15(7-13)20(23-10-22-16)25-14-4-6-19-17(8-14)24-11-27-19/h3-11H,1-2H3,(H,22,23,25).
What are the key properties of N-[6-(2,3-dimethylimidazol-4-yl)quinazolin-4-yl]-1,3-benzothiazol-5-amine?
N-[6-(2,3-dimethylimidazol-4-yl)quinazolin-4-yl]-1,3-benzothiazol-5-amine has a molecular weight of 372.46 g/mol, XLogP of 4.69, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(2,3-dimethylimidazol-4-yl)quinazolin-4-yl]-1,3-benzothiazol-5-amine is sourced from PubChem (CID 177371840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).