C22H26FN5O4 — CID 177371913
N-[3-[(5-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]propyl]-5-methyl-1-(2-methylpropyl)indole-2-carboxamide (PubChem CID 177371913) has the molecular formula C22H26FN5O4 and a molecular weight of 443.48 g/mol. Its IUPAC name is N-[3-[(5-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]propyl]-5-methyl-1-(2-methylpropyl)indole-2-carboxamide.
| Compound Name | N-[3-[(5-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]propyl]-5-methyl-1-(2-methylpropyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 177371913 |
| Molecular Formula | C22H26FN5O4 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | N-[3-[(5-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]propyl]-5-methyl-1-(2-methylpropyl)indole-2-carboxamide |
| SMILES | Cc1ccc2c(c1)cc(C(=O)NCCCNC(=O)n1cc(F)c(=O)[nH]c1=O)n2CC(C)C |
| InChI | InChI=1S/C22H26FN5O4/c1-13(2)11-27-17-6-5-14(3)9-15(17)10-18(27)20(30)24-7-4-8-25-21(31)28-12-16(23)19(29)26-22(28)32/h5-6,9-10,12-13H,4,7-8,11H2,1-3H3,(H,24,30)(H,25,31)(H,26,29,32) |
| InChIKey | YHWUKRCQVMSDIV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|