C26H17N5O3S — CID 177372339
2-[(2-nitrophenyl)methylsulfanyl]-5-(1-phenyl-9H-pyrido[3,4-b]indol-3-yl)-1,3,4-oxadiazole (PubChem CID 177372339) has the molecular formula C26H17N5O3S and a molecular weight of 479.52 g/mol. Its IUPAC name is 2-[(2-nitrophenyl)methylsulfanyl]-5-(1-phenyl-9H-pyrido[3,4-b]indol-3-yl)-1,3,4-oxadiazole.
| Compound Name | 2-[(2-nitrophenyl)methylsulfanyl]-5-(1-phenyl-9H-pyrido[3,4-b]indol-3-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 177372339 |
| Molecular Formula | C26H17N5O3S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 2-[(2-nitrophenyl)methylsulfanyl]-5-(1-phenyl-9H-pyrido[3,4-b]indol-3-yl)-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccccc1CSc1nnc(-c2cc3c([nH]c4ccccc43)c(-c3ccccc3)n2)o1 |
| InChI | InChI=1S/C26H17N5O3S/c32-31(33)22-13-7-4-10-17(22)15-35-26-30-29-25(34-26)21-14-19-18-11-5-6-12-20(18)27-24(19)23(28-21)16-8-2-1-3-9-16/h1-14,27H,15H2 |
| InChIKey | VILIYTDYDXPHJG-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|