About 4-[[5,5-dimethyl-8-(4-morpholin-4-ylphenyl)-6H-naphthalene-2-carbonyl]amino]benzoic acid
4-[[5,5-dimethyl-8-(4-morpholin-4-ylphenyl)-6H-naphthalene-2-carbonyl]amino]benzoic acid (PubChem CID 177372374) has the molecular formula C30H30N2O4
and a molecular weight of 482.58 g/mol. Its IUPAC name is 4-[[5,5-dimethyl-8-(4-morpholin-4-ylphenyl)-6H-naphthalene-2-carbonyl]amino]benzoic acid.
Molecular Properties
| Compound Name | 4-[[5,5-dimethyl-8-(4-morpholin-4-ylphenyl)-6H-naphthalene-2-carbonyl]amino]benzoic acid |
| PubChem CID | 177372374 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 4-[[5,5-dimethyl-8-(4-morpholin-4-ylphenyl)-6H-naphthalene-2-carbonyl]amino]benzoic acid |
| SMILES | CC1(C)CC=C(c2ccc(N3CCOCC3)cc2)c2cc(C(=O)Nc3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C30H30N2O4/c1-30(2)14-13-25(20-5-10-24(11-6-20)32-15-17-36-18-16-32)26-19-22(7-12-27(26)30)28(33)31-23-8-3-21(4-9-23)29(34)35/h3-13,19H,14-18H2,1-2H3,(H,31,33)(H,34,35) |
| InChIKey | KGKNZAFDQDSTMO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|
Analyze 4-[[5,5-dimethyl-8-(4-morpholin-4-ylphenyl)-6H-naphthalene-2-carbonyl]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5,5-dimethyl-8-(4-morpholin-4-ylphenyl)-6H-naphthalene-2-carbonyl]amino]benzoic acid?
The IUPAC name of 4-[[5,5-dimethyl-8-(4-morpholin-4-ylphenyl)-6H-naphthalene-2-carbonyl]amino]benzoic acid (CID 177372374) is 4-[[5,5-dimethyl-8-(4-morpholin-4-ylphenyl)-6H-naphthalene-2-carbonyl]amino]benzoic acid.
What is the SMILES notation for 4-[[5,5-dimethyl-8-(4-morpholin-4-ylphenyl)-6H-naphthalene-2-carbonyl]amino]benzoic acid?
The canonical SMILES for 4-[[5,5-dimethyl-8-(4-morpholin-4-ylphenyl)-6H-naphthalene-2-carbonyl]amino]benzoic acid is CC1(C)CC=C(c2ccc(N3CCOCC3)cc2)c2cc(C(=O)Nc3ccc(C(=O)O)cc3)ccc21.
What is the InChIKey of 4-[[5,5-dimethyl-8-(4-morpholin-4-ylphenyl)-6H-naphthalene-2-carbonyl]amino]benzoic acid?
The InChIKey is KGKNZAFDQDSTMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H30N2O4/c1-30(2)14-13-25(20-5-10-24(11-6-20)32-15-17-36-18-16-32)26-19-22(7-12-27(26)30)28(33)31-23-8-3-21(4-9-23)29(34)35/h3-13,19H,14-18H2,1-2H3,(H,31,33)(H,34,35).
What are the key properties of 4-[[5,5-dimethyl-8-(4-morpholin-4-ylphenyl)-6H-naphthalene-2-carbonyl]amino]benzoic acid?
4-[[5,5-dimethyl-8-(4-morpholin-4-ylphenyl)-6H-naphthalene-2-carbonyl]amino]benzoic acid has a molecular weight of 482.58 g/mol, XLogP of 5.59, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5,5-dimethyl-8-(4-morpholin-4-ylphenyl)-6H-naphthalene-2-carbonyl]amino]benzoic acid is sourced from PubChem (CID 177372374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).