About 4-[[2,2-dimethyl-4-(4-methylphenyl)chromen-6-yl]sulfamoyl]benzoic acid
4-[[2,2-dimethyl-4-(4-methylphenyl)chromen-6-yl]sulfamoyl]benzoic acid (PubChem CID 177372392) has the molecular formula C25H23NO5S
and a molecular weight of 449.53 g/mol. Its IUPAC name is 4-[[2,2-dimethyl-4-(4-methylphenyl)chromen-6-yl]sulfamoyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[[2,2-dimethyl-4-(4-methylphenyl)chromen-6-yl]sulfamoyl]benzoic acid |
| PubChem CID | 177372392 |
| Molecular Formula | C25H23NO5S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 4-[[2,2-dimethyl-4-(4-methylphenyl)chromen-6-yl]sulfamoyl]benzoic acid |
| SMILES | Cc1ccc(C2=CC(C)(C)Oc3ccc(NS(=O)(=O)c4ccc(C(=O)O)cc4)cc32)cc1 |
| InChI | InChI=1S/C25H23NO5S/c1-16-4-6-17(7-5-16)22-15-25(2,3)31-23-13-10-19(14-21(22)23)26-32(29,30)20-11-8-18(9-12-20)24(27)28/h4-15,26H,1-3H3,(H,27,28) |
| InChIKey | HJGHWKJMGWNFPU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[2,2-dimethyl-4-(4-methylphenyl)chromen-6-yl]sulfamoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2,2-dimethyl-4-(4-methylphenyl)chromen-6-yl]sulfamoyl]benzoic acid?
The IUPAC name of 4-[[2,2-dimethyl-4-(4-methylphenyl)chromen-6-yl]sulfamoyl]benzoic acid (CID 177372392) is 4-[[2,2-dimethyl-4-(4-methylphenyl)chromen-6-yl]sulfamoyl]benzoic acid.
What is the SMILES notation for 4-[[2,2-dimethyl-4-(4-methylphenyl)chromen-6-yl]sulfamoyl]benzoic acid?
The canonical SMILES for 4-[[2,2-dimethyl-4-(4-methylphenyl)chromen-6-yl]sulfamoyl]benzoic acid is Cc1ccc(C2=CC(C)(C)Oc3ccc(NS(=O)(=O)c4ccc(C(=O)O)cc4)cc32)cc1.
What is the InChIKey of 4-[[2,2-dimethyl-4-(4-methylphenyl)chromen-6-yl]sulfamoyl]benzoic acid?
The InChIKey is HJGHWKJMGWNFPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23NO5S/c1-16-4-6-17(7-5-16)22-15-25(2,3)31-23-13-10-19(14-21(22)23)26-32(29,30)20-11-8-18(9-12-20)24(27)28/h4-15,26H,1-3H3,(H,27,28).
What are the key properties of 4-[[2,2-dimethyl-4-(4-methylphenyl)chromen-6-yl]sulfamoyl]benzoic acid?
4-[[2,2-dimethyl-4-(4-methylphenyl)chromen-6-yl]sulfamoyl]benzoic acid has a molecular weight of 449.53 g/mol, XLogP of 5.10, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2,2-dimethyl-4-(4-methylphenyl)chromen-6-yl]sulfamoyl]benzoic acid is sourced from PubChem (CID 177372392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).