C26H19NO3S2 — CID 177372401
(5Z)-3-[(4-methylphenyl)methyl]-5-[(5-naphthalen-2-yloxythiophen-2-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 177372401) has the molecular formula C26H19NO3S2 and a molecular weight of 457.58 g/mol. Its IUPAC name is (5Z)-3-[(4-methylphenyl)methyl]-5-[(5-naphthalen-2-yloxythiophen-2-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[(4-methylphenyl)methyl]-5-[(5-naphthalen-2-yloxythiophen-2-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 177372401 |
| Molecular Formula | C26H19NO3S2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | (5Z)-3-[(4-methylphenyl)methyl]-5-[(5-naphthalen-2-yloxythiophen-2-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(CN2C(=O)S/C(=C\c3ccc(Oc4ccc5ccccc5c4)s3)C2=O)cc1 |
| InChI | InChI=1S/C26H19NO3S2/c1-17-6-8-18(9-7-17)16-27-25(28)23(32-26(27)29)15-22-12-13-24(31-22)30-21-11-10-19-4-2-3-5-20(19)14-21/h2-15H,16H2,1H3/b23-15- |
| InChIKey | HCKMTHLYPNHWOD-HAHDFKILSA-N |
| XLogP | 7.24 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|