C32H30F2N6O3 — CID 177372723
(4aS,8aR)-2-[(3,4-difluorophenyl)methyl]-4-[3-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 177372723) has the molecular formula C32H30F2N6O3 and a molecular weight of 584.63 g/mol. Its IUPAC name is (4aS,8aR)-2-[(3,4-difluorophenyl)methyl]-4-[3-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | (4aS,8aR)-2-[(3,4-difluorophenyl)methyl]-4-[3-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 177372723 |
| Molecular Formula | C32H30F2N6O3 |
| Molecular Weight | 584.63 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | (4aS,8aR)-2-[(3,4-difluorophenyl)methyl]-4-[3-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | O=C1[C@@H]2CC=CC[C@@H]2C(c2cccc(OCCCCOc3ccc(-c4nn[nH]n4)cc3)c2)=NN1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C32H30F2N6O3/c33-28-15-10-21(18-29(28)34)20-40-32(41)27-9-2-1-8-26(27)30(37-40)23-6-5-7-25(19-23)43-17-4-3-16-42-24-13-11-22(12-14-24)31-35-38-39-36-31/h1-2,5-7,10-15,18-19,26-27H,3-4,8-9,16-17,20H2,(H,35,36,38,39)/t26-,27+/m0/s1 |
| InChIKey | WEKHUSPBCUGINX-RRPNLBNLSA-N |
| XLogP | 5.71 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|