C33H40N6O3 — CID 177372725
(4aS,8aR)-2-cycloheptyl-4-[3-[5-[4-(2H-tetrazol-5-yl)phenoxy]pentoxy]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 177372725) has the molecular formula C33H40N6O3 and a molecular weight of 568.72 g/mol. Its IUPAC name is (4aS,8aR)-2-cycloheptyl-4-[3-[5-[4-(2H-tetrazol-5-yl)phenoxy]pentoxy]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | (4aS,8aR)-2-cycloheptyl-4-[3-[5-[4-(2H-tetrazol-5-yl)phenoxy]pentoxy]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 177372725 |
| Molecular Formula | C33H40N6O3 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.32 |
| IUPAC Name | (4aS,8aR)-2-cycloheptyl-4-[3-[5-[4-(2H-tetrazol-5-yl)phenoxy]pentoxy]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | O=C1[C@@H]2CC=CC[C@@H]2C(c2cccc(OCCCCCOc3ccc(-c4nn[nH]n4)cc3)c2)=NN1C1CCCCCC1 |
| InChI | InChI=1S/C33H40N6O3/c40-33-30-16-7-6-15-29(30)31(36-39(33)26-12-4-1-2-5-13-26)25-11-10-14-28(23-25)42-22-9-3-8-21-41-27-19-17-24(18-20-27)32-34-37-38-35-32/h6-7,10-11,14,17-20,23,26,29-30H,1-5,8-9,12-13,15-16,21-22H2,(H,34,35,37,38)/t29-,30+/m0/s1 |
| InChIKey | IIXXNCMPBJGUMQ-XZWHSSHBSA-N |
| XLogP | 6.35 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|