C32H36N6O3 — CID 177372726
(4aS,8aR)-2-cycloheptyl-4-[3-[(Z)-4-[4-(2H-tetrazol-5-yl)phenoxy]but-2-enoxy]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 177372726) has the molecular formula C32H36N6O3 and a molecular weight of 552.68 g/mol. Its IUPAC name is (4aS,8aR)-2-cycloheptyl-4-[3-[(Z)-4-[4-(2H-tetrazol-5-yl)phenoxy]but-2-enoxy]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | (4aS,8aR)-2-cycloheptyl-4-[3-[(Z)-4-[4-(2H-tetrazol-5-yl)phenoxy]but-2-enoxy]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 177372726 |
| Molecular Formula | C32H36N6O3 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | (4aS,8aR)-2-cycloheptyl-4-[3-[(Z)-4-[4-(2H-tetrazol-5-yl)phenoxy]but-2-enoxy]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | O=C1[C@@H]2CC=CC[C@@H]2C(c2cccc(OC/C=C\COc3ccc(-c4nn[nH]n4)cc3)c2)=NN1C1CCCCCC1 |
| InChI | InChI=1S/C32H36N6O3/c39-32-29-15-6-5-14-28(29)30(35-38(32)25-11-3-1-2-4-12-25)24-10-9-13-27(22-24)41-21-8-7-20-40-26-18-16-23(17-19-26)31-33-36-37-34-31/h5-10,13,16-19,22,25,28-29H,1-4,11-12,14-15,20-21H2,(H,33,34,36,37)/b8-7-/t28-,29+/m0/s1 |
| InChIKey | UGGPIPXIWDQRBE-HTRAZSPESA-N |
| XLogP | 5.73 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|