C38H40ClF2N3O — CID 177373202
3-[5-chloro-6-[3-[difluoro(phenyl)methyl]-5-methylphenyl]-3-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)naphthalen-1-yl]-3,8-diazabicyclo[3.2.1]octane (PubChem CID 177373202) has the molecular formula C38H40ClF2N3O and a molecular weight of 628.21 g/mol. Its IUPAC name is 3-[5-chloro-6-[3-[difluoro(phenyl)methyl]-5-methylphenyl]-3-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)naphthalen-1-yl]-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | 3-[5-chloro-6-[3-[difluoro(phenyl)methyl]-5-methylphenyl]-3-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)naphthalen-1-yl]-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 177373202 |
| Molecular Formula | C38H40ClF2N3O |
| Molecular Weight | 628.21 g/mol |
| Exact Mass | 627.28 |
| IUPAC Name | 3-[5-chloro-6-[3-[difluoro(phenyl)methyl]-5-methylphenyl]-3-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)naphthalen-1-yl]-3,8-diazabicyclo[3.2.1]octane |
| SMILES | Cc1cc(-c2ccc3c(N4CC5CCC(C4)N5)cc(OCC45CCCN4CCC5)cc3c2Cl)cc(C(F)(F)c2ccccc2)c1 |
| InChI | InChI=1S/C38H40ClF2N3O/c1-25-17-26(19-28(18-25)38(40,41)27-7-3-2-4-8-27)32-11-12-33-34(36(32)39)20-31(45-24-37-13-5-15-44(37)16-6-14-37)21-35(33)43-22-29-9-10-30(23-43)42-29/h2-4,7-8,11-12,17-21,29-30,42H,5-6,9-10,13-16,22-24H2,1H3 |
| InChIKey | PDQVRINEVNDDPY-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.21 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |