C18H17N3O4S2 — CID 177373826
4-[[(5E)-5-[(4-methoxyphenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzenesulfonamide (PubChem CID 177373826) has the molecular formula C18H17N3O4S2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 4-[[(5E)-5-[(4-methoxyphenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzenesulfonamide.
| Compound Name | 4-[[(5E)-5-[(4-methoxyphenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 177373826 |
| Molecular Formula | C18H17N3O4S2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 4-[[(5E)-5-[(4-methoxyphenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzenesulfonamide |
| SMILES | COc1ccc(/C=C2/S/C(=N/c3ccc(S(N)(=O)=O)cc3)N(C)C2=O)cc1 |
| InChI | InChI=1S/C18H17N3O4S2/c1-21-17(22)16(11-12-3-7-14(25-2)8-4-12)26-18(21)20-13-5-9-15(10-6-13)27(19,23)24/h3-11H,1-2H3,(H2,19,23,24)/b16-11+,20-18+ |
| InChIKey | PWSHEANFGGGKBV-YYUDZJCFSA-N |
| XLogP | 2.58 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|