C23H17FN4O2 — CID 177373844
N-(4-fluorophenyl)-2-(3-oxo-5,6-diphenyl-1,2,4-triazin-2-yl)acetamide (PubChem CID 177373844) has the molecular formula C23H17FN4O2 and a molecular weight of 400.41 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-(3-oxo-5,6-diphenyl-1,2,4-triazin-2-yl)acetamide.
| Compound Name | N-(4-fluorophenyl)-2-(3-oxo-5,6-diphenyl-1,2,4-triazin-2-yl)acetamide |
|---|---|
| PubChem CID | 177373844 |
| Molecular Formula | C23H17FN4O2 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N-(4-fluorophenyl)-2-(3-oxo-5,6-diphenyl-1,2,4-triazin-2-yl)acetamide |
| SMILES | O=C(Cn1nc(-c2ccccc2)c(-c2ccccc2)nc1=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C23H17FN4O2/c24-18-11-13-19(14-12-18)25-20(29)15-28-23(30)26-21(16-7-3-1-4-8-16)22(27-28)17-9-5-2-6-10-17/h1-14H,15H2,(H,25,29) |
| InChIKey | SDIIOKMAQAQRQY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |