C23H16F2N4O2 — CID 177373853
N-(2,4-difluorophenyl)-2-(3-oxo-5,6-diphenyl-1,2,4-triazin-2-yl)acetamide (PubChem CID 177373853) has the molecular formula C23H16F2N4O2 and a molecular weight of 418.40 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-(3-oxo-5,6-diphenyl-1,2,4-triazin-2-yl)acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-(3-oxo-5,6-diphenyl-1,2,4-triazin-2-yl)acetamide |
|---|---|
| PubChem CID | 177373853 |
| Molecular Formula | C23H16F2N4O2 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-(3-oxo-5,6-diphenyl-1,2,4-triazin-2-yl)acetamide |
| SMILES | O=C(Cn1nc(-c2ccccc2)c(-c2ccccc2)nc1=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C23H16F2N4O2/c24-17-11-12-19(18(25)13-17)26-20(30)14-29-23(31)27-21(15-7-3-1-4-8-15)22(28-29)16-9-5-2-6-10-16/h1-13H,14H2,(H,26,30) |
| InChIKey | WNNYXKZYAUWGQX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |