C32H32ClN7O2S — CID 177373896
(E)-N-[1-[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]piperidin-4-yl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 177373896) has the molecular formula C32H32ClN7O2S and a molecular weight of 614.18 g/mol. Its IUPAC name is (E)-N-[1-[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]piperidin-4-yl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[1-[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]piperidin-4-yl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 177373896 |
| Molecular Formula | C32H32ClN7O2S |
| Molecular Weight | 614.18 g/mol |
| Exact Mass | 613.20 |
| IUPAC Name | (E)-N-[1-[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]piperidin-4-yl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)N1CCC(NC(=O)/C=C/c3cccnc3)CC1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C32H32ClN7O2S/c1-19-20(2)43-32-29(19)30(23-7-9-24(33)10-8-23)36-26(31-38-37-21(3)40(31)32)17-28(42)39-15-12-25(13-16-39)35-27(41)11-6-22-5-4-14-34-18-22/h4-11,14,18,25-26H,12-13,15-17H2,1-3H3,(H,35,41)/b11-6+/t26-/m0/s1 |
| InChIKey | UDNHUXIKUJNFIO-KDZJVGDTSA-N |
| XLogP | 5.41 |
| TPSA | 105.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.18 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|