C18H16N4O5 — CID 177373912
N-(3-imidazol-1-ylpropyl)-3,7-dimethyl-4,8-dioxofuro[2,3-f][1,2]benzoxazole-6-carboxamide (PubChem CID 177373912) has the molecular formula C18H16N4O5 and a molecular weight of 368.35 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-3,7-dimethyl-4,8-dioxofuro[2,3-f][1,2]benzoxazole-6-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-3,7-dimethyl-4,8-dioxofuro[2,3-f][1,2]benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 177373912 |
| Molecular Formula | C18H16N4O5 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-3,7-dimethyl-4,8-dioxofuro[2,3-f][1,2]benzoxazole-6-carboxamide |
| SMILES | Cc1noc2c1C(=O)c1oc(C(=O)NCCCn3ccnc3)c(C)c1C2=O |
| InChI | InChI=1S/C18H16N4O5/c1-9-11-13(23)17-12(10(2)21-27-17)14(24)16(11)26-15(9)18(25)20-4-3-6-22-7-5-19-8-22/h5,7-8H,3-4,6H2,1-2H3,(H,20,25) |
| InChIKey | JNMKWBZTWICKJM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 120.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|