C18H20N6O2 — CID 177374165
8-[2-(1H-indol-3-yl)ethylamino]-1,3,7-trimethylpurine-2,6-dione (PubChem CID 177374165) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 8-[2-(1H-indol-3-yl)ethylamino]-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-[2-(1H-indol-3-yl)ethylamino]-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 177374165 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 8-[2-(1H-indol-3-yl)ethylamino]-1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(NCCc3c[nH]c4ccccc34)n2C)n(C)c1=O |
| InChI | InChI=1S/C18H20N6O2/c1-22-14-15(23(2)18(26)24(3)16(14)25)21-17(22)19-9-8-11-10-20-13-7-5-4-6-12(11)13/h4-7,10,20H,8-9H2,1-3H3,(H,19,21) |
| InChIKey | MZRJWDYGKMCOEU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 89.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |