C19H22N6O2 — CID 177374166
1-ethyl-8-[2-(1H-indol-3-yl)ethylamino]-3,7-dimethylpurine-2,6-dione (PubChem CID 177374166) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is 1-ethyl-8-[2-(1H-indol-3-yl)ethylamino]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-ethyl-8-[2-(1H-indol-3-yl)ethylamino]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 177374166 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 1-ethyl-8-[2-(1H-indol-3-yl)ethylamino]-3,7-dimethylpurine-2,6-dione |
| SMILES | CCn1c(=O)c2c(nc(NCCc3c[nH]c4ccccc34)n2C)n(C)c1=O |
| InChI | InChI=1S/C19H22N6O2/c1-4-25-17(26)15-16(24(3)19(25)27)22-18(23(15)2)20-10-9-12-11-21-14-8-6-5-7-13(12)14/h5-8,11,21H,4,9-10H2,1-3H3,(H,20,22) |
| InChIKey | QCWUBNAMJPVENK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 89.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |