C20H24N6O2 — CID 177374167
8-[2-(1H-indol-3-yl)ethylamino]-3,7-dimethyl-1-propylpurine-2,6-dione (PubChem CID 177374167) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 8-[2-(1H-indol-3-yl)ethylamino]-3,7-dimethyl-1-propylpurine-2,6-dione.
| Compound Name | 8-[2-(1H-indol-3-yl)ethylamino]-3,7-dimethyl-1-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 177374167 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 8-[2-(1H-indol-3-yl)ethylamino]-3,7-dimethyl-1-propylpurine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(NCCc3c[nH]c4ccccc34)n2C)n(C)c1=O |
| InChI | InChI=1S/C20H24N6O2/c1-4-11-26-18(27)16-17(25(3)20(26)28)23-19(24(16)2)21-10-9-13-12-22-15-8-6-5-7-14(13)15/h5-8,12,22H,4,9-11H2,1-3H3,(H,21,23) |
| InChIKey | WJXQJYBWBJIRHX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 89.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |