C31H37ClN2O5S — CID 177374563
(8'E)-6-chloro-7'-hydroxy-11',12'-dimethyl-13',13'-dioxospiro[1,2-dihydroindene-3,22'-20-oxa-13λ6-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-8,16(25),17,19(24)-tetraene]-15'-one (PubChem CID 177374563) has the molecular formula C31H37ClN2O5S and a molecular weight of 585.17 g/mol. Its IUPAC name is (8'E)-6-chloro-7'-hydroxy-11',12'-dimethyl-13',13'-dioxospiro[1,2-dihydroindene-3,22'-20-oxa-13λ6-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-8,16(25),17,19(24)-tetraene]-15'-one.
| Compound Name | (8'E)-6-chloro-7'-hydroxy-11',12'-dimethyl-13',13'-dioxospiro[1,2-dihydroindene-3,22'-20-oxa-13λ6-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-8,16(25),17,19(24)-tetraene]-15'-one |
|---|---|
| PubChem CID | 177374563 |
| Molecular Formula | C31H37ClN2O5S |
| Molecular Weight | 585.17 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | (8'E)-6-chloro-7'-hydroxy-11',12'-dimethyl-13',13'-dioxospiro[1,2-dihydroindene-3,22'-20-oxa-13λ6-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-8,16(25),17,19(24)-tetraene]-15'-one |
| SMILES | CC1C/C=C/C(O)C2CCC2CN2CC3(CCc4cc(Cl)ccc43)COc3ccc(cc32)C(=O)NS(=O)(=O)C1C |
| InChI | InChI=1S/C31H37ClN2O5S/c1-19-4-3-5-28(35)25-9-6-23(25)16-34-17-31(13-12-21-14-24(32)8-10-26(21)31)18-39-29-11-7-22(15-27(29)34)30(36)33-40(37,38)20(19)2/h3,5,7-8,10-11,14-15,19-20,23,25,28,35H,4,6,9,12-13,16-18H2,1-2H3,(H,33,36)/b5-3+ |
| InChIKey | ISJBGABZIRLDNK-HWKANZROSA-N |
| XLogP | 4.85 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.17 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|